Products 20227-26-3

CAS 20227-26-3 is the registry number for Lumiflavin-3-acetic Acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 5mg, 2mg, 10mg.

Structural formula: {0} (CAS {1})

2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid (CAS 20227-26-3) is a chemical compound with the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. IUPAC name: 2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid. InChIKey: GJSCQGXLPDWOMG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N4O4
Molecular weight314.30 g/mol
IUPAC name2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid
InChIKeyGJSCQGXLPDWOMG-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C)N(C3=NC(=O)N(C(=O)C3=N2)CC(=O)O)C

Computed by PubChem (NCBI)