CAS 20227-26-3 is the registry number for Lumiflavin-3-acetic Acid. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 5mg, 2mg, 10mg.
2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid (CAS 20227-26-3) is a chemical compound with the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. IUPAC name: 2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid. InChIKey: GJSCQGXLPDWOMG-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O4 |
|---|---|
| Molecular weight | 314.30 g/mol |
| IUPAC name | 2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid |
| InChIKey | GJSCQGXLPDWOMG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)N(C(=O)C3=N2)CC(=O)O)C |
Computed by PubChem (NCBI)