CAS 2023-48-5 appears in our catalog under these names: Triphenylbismuth difluoride, 95%, Triphenylbismuth difluoride, Triphenylbismuth Difluoride, >97.0%(T). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 5g, 250mg.
Difluoro(triphenyl)bismuth (CAS 2023-48-5) is a chemical compound with the molecular formula C18H15BiF2 and a molecular weight of 478.3 g/mol. IUPAC name: difluoro(triphenyl)bismuth. InChIKey: OSGJIYNQSIPLAQ-UHFFFAOYSA-L.
| Molecular formula | C18H15BiF2 |
|---|---|
| Molecular weight | 478.3 g/mol |
| IUPAC name | difluoro(triphenyl)bismuth |
| InChIKey | OSGJIYNQSIPLAQ-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)[Bi](C2=CC=CC=C2)(C3=CC=CC=C3)(F)F |
Computed by PubChem (NCBI)