Products 202326-54-3

CAS 202326-54-3 is the registry number for Acrylic Acid-13C3. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

(1,2,3-13C3)prop-2-enoic acid (CAS 202326-54-3) is a chemical compound with the molecular formula C3H4O2 and a molecular weight of 75.041 g/mol. IUPAC name: (1,2,3-13C3)prop-2-enoic acid. InChIKey: NIXOWILDQLNWCW-VMIGTVKRSA-N.

Identity
Molecular formulaC3H4O2
Molecular weight75.041 g/mol
IUPAC name(1,2,3-13C3)prop-2-enoic acid
InChIKeyNIXOWILDQLNWCW-VMIGTVKRSA-N
SMILES[13CH2]=[13CH][13C](=O)O

Computed by PubChem (NCBI)