CAS 202330-66-3 is the registry number for 4-Fluoro-1-N,3-N-dimethyl-6-nitrobenzene-1,3-diamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-fluoro-1-N,3-N-dimethyl-6-nitrobenzene-1,3-diamine (CAS 202330-66-3) is a chemical compound with the molecular formula C8H10FN3O2 and a molecular weight of 199.18 g/mol. IUPAC name: 4-fluoro-1-N,3-N-dimethyl-6-nitrobenzene-1,3-diamine. InChIKey: JSPGKQOVOPWMNL-UHFFFAOYSA-N.
| Molecular formula | C8H10FN3O2 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 4-fluoro-1-N,3-N-dimethyl-6-nitrobenzene-1,3-diamine |
| InChIKey | JSPGKQOVOPWMNL-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=C(C=C1[N+](=O)[O-])F)NC |
Computed by PubChem (NCBI)