CAS 202338-43-0 is the registry number for (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl Phosphorodichloridate. Offered by: TRC. Available pack sizes: 50mg.
4-(dichlorophosphoryloxymethyl)-2,2-dimethyl-1,3-dioxolane (CAS 202338-43-0) is a chemical compound with the molecular formula C6H11Cl2O4P and a molecular weight of 249.03 g/mol. IUPAC name: 4-(dichlorophosphoryloxymethyl)-2,2-dimethyl-1,3-dioxolane. InChIKey: IWJCUBRAVZETKB-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2O4P |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 4-(dichlorophosphoryloxymethyl)-2,2-dimethyl-1,3-dioxolane |
| InChIKey | IWJCUBRAVZETKB-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)COP(=O)(Cl)Cl)C |
Computed by PubChem (NCBI)