CAS 2023781-30-6 appears in our catalog under these names: rel-(1R,3R)-2,2-Dichloro-3-(3,5-dichlorophenyl)cyclopropanecarboxylic acid, 98%, 98%, rel-(1R,3R)-2,2-Dichloro-3-(3,5-dichlorophenyl)cyclopropanecarboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Trans-(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 2023781-30-6) is a chemical compound with the molecular formula C10H6Cl4O2 and a molecular weight of 300.0 g/mol. IUPAC name: trans-(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: NMKOKSUKNNQZBF-JGVFFNPUSA-N.
| Molecular formula | C10H6Cl4O2 |
|---|---|
| Molecular weight | 300.0 g/mol |
| IUPAC name | trans-(1R,3R)-2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | NMKOKSUKNNQZBF-JGVFFNPUSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)[C@H]2[C@@H](C2(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)