CAS 2024278-93-9 appears in our catalog under these names: 1-(2-Azidoethyl)-4,4-difluoropiperidine, 1-(2-Azidoethyl)-4,4-difluoropiperidine, min. 95 %, 50 mg, 1-(2-Azidoethyl)-4,4-difluoropiperidine, min. 95 %, 100 mg, 1-(2-Azidoethyl)-4,4-difluoropiperidine, min. 95 %, 500 mg, 1-(2-Azidoethyl)-4,4-difluoropiperidine, min. 95 %, 1 g. Offered by: Biosynth, Roth. Available pack sizes: 50mg, 0,5g, 100mg, 500mg, 1g.
1-(2-azidoethyl)-4,4-difluoropiperidine (CAS 2024278-93-9) is a chemical compound with the molecular formula C7H12F2N4 and a molecular weight of 190.19 g/mol. IUPAC name: 1-(2-azidoethyl)-4,4-difluoropiperidine. InChIKey: KVRNRPWABOPYEZ-UHFFFAOYSA-N.
| Molecular formula | C7H12F2N4 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 1-(2-azidoethyl)-4,4-difluoropiperidine |
| InChIKey | KVRNRPWABOPYEZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)