CAS 2024584-38-9 is the registry number for Seletracetam (lithium bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
Lithium;(2S)-2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanamide;bromide (CAS 2024584-38-9) is a chemical compound with the molecular formula C10H14BrF2LiN2O2 and a molecular weight of 319.1 g/mol. IUPAC name: lithium;(2S)-2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanamide;bromide. InChIKey: JLPMYEPKIQRREQ-VJBFUYBPSA-M.
| Molecular formula | C10H14BrF2LiN2O2 |
|---|---|
| Molecular weight | 319.1 g/mol |
| IUPAC name | lithium;(2S)-2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanamide;bromide |
| InChIKey | JLPMYEPKIQRREQ-VJBFUYBPSA-M |
| SMILES | [Li+].CC[C@@H](C(=O)N)N1C[C@@H](CC1=O)C=C(F)F.[Br-] |
Computed by PubChem (NCBI)