Products 202466-84-0
CAS 202466-84-0 is the registry number for 4-Amino-N-(3,5-dimethoxyphenyl)benzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-N-(3,5-dimethoxyphenyl)benzenesulfonamide (CAS 202466-84-0) is a chemical compound with the molecular formula C14H16N2O4S and a molecular weight of 308.35 g/mol. IUPAC name: 4-amino-N-(3,5-dimethoxyphenyl)benzenesulfonamide. InChIKey: MQFOJBDFKXNQSH-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4S |
|---|---|
| Molecular weight | 308.35 g/mol |
| IUPAC name | 4-amino-N-(3,5-dimethoxyphenyl)benzenesulfonamide |
| InChIKey | MQFOJBDFKXNQSH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N)OC |
Computed by PubChem (NCBI)