Products 2024691-86-7

CAS 2024691-86-7 is the registry number for 1-(2,6-Dichloro-4-nitrophenyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(2,6-dichloro-4-nitrophenyl)cyclopropane-1-carboxylic acid (CAS 2024691-86-7) is a chemical compound with the molecular formula C10H7Cl2NO4 and a molecular weight of 276.07 g/mol. IUPAC name: 1-(2,6-dichloro-4-nitrophenyl)cyclopropane-1-carboxylic acid. InChIKey: FLEZLVPSDUTRNF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7Cl2NO4
Molecular weight276.07 g/mol
IUPAC name1-(2,6-dichloro-4-nitrophenyl)cyclopropane-1-carboxylic acid
InChIKeyFLEZLVPSDUTRNF-UHFFFAOYSA-N
SMILESC1CC1(C2=C(C=C(C=C2Cl)[N+](=O)[O-])Cl)C(=O)O

Computed by PubChem (NCBI)