Products 202480-74-8
CAS 202480-74-8 appears in our catalog under these names: 1,2-Propylene-d6 Carbonate, (±)-1,2-Propylene-d6 Carbonate, 98 atom % D, min 98% Chemical Purity, 1,2–Propylene–d6 carbonate, 1,2-Propylene-d6 carbonate, 98.65%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1g, 0,5g, 10mg, 25mg, 5mg, 50 mg, 10 mg.
4,4,5-trideuterio-5-(trideuteriomethyl)-1,3-dioxolan-2-one (CAS 202480-74-8) is a chemical compound with the molecular formula C4H6O3 and a molecular weight of 108.13 g/mol. IUPAC name: 4,4,5-trideuterio-5-(trideuteriomethyl)-1,3-dioxolan-2-one. InChIKey: RUOJZAUFBMNUDX-LIDOUZCJSA-N.
| Molecular formula | C4H6O3 |
|---|---|
| Molecular weight | 108.13 g/mol |
| IUPAC name | 4,4,5-trideuterio-5-(trideuteriomethyl)-1,3-dioxolan-2-one |
| InChIKey | RUOJZAUFBMNUDX-LIDOUZCJSA-N |
| SMILES | [2H]C1(C(OC(=O)O1)([2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
1,2-Propylene-d6 carbonate, 4,4,5-trideuterio-5-(trideuteriomethyl)-1,3-dioxolan-2-one, 1,2-Propylene carbonate-d6, (+/-)-1,2-Propylene-d6 Carbonate, 1,3-Dioxolan-2-one-4,4,5-d3, 5-(methyl-d3)- (9CI), 1,2-Propylene carbonate, (D6, 98%), 1,2-Propylene-d6 carbonate, 98 atom % D, 98% (CP), 4-(~2~H_3_)Methyl(~2~H_3_)-1,3-dioxolan-2-one