CAS 20255-70-3 appears in our catalog under these names: Bis(4-iodophenyl)amine, 95-<97%, Bis(4-iodophenyl)amine, ≥97-<99%, Bis(4–iodophenyl)amine, Bis(4-iodophenyl)amine, >98.0%(GC), Bis(4-iodophenyl)amine 95%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 25g.
4-iodo-N-(4-iodophenyl)aniline (CAS 20255-70-3) is a chemical compound with the molecular formula C12H9I2N and a molecular weight of 421.01 g/mol. IUPAC name: 4-iodo-N-(4-iodophenyl)aniline. InChIKey: SJLIWXXAQHNDHM-UHFFFAOYSA-N.
| Molecular formula | C12H9I2N |
|---|---|
| Molecular weight | 421.01 g/mol |
| IUPAC name | 4-iodo-N-(4-iodophenyl)aniline |
| InChIKey | SJLIWXXAQHNDHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)I)I |
Computed by PubChem (NCBI)