CAS 202656-13-1 appears in our catalog under these names: TRIS-d11 (crystalline), 98 atom % D, min 98% Chemical Purity, TRIS(HYDROXYMETHYL-D3)AMINO-D2-METHANE,, THAM-d11 (for molecular biology), 99.88%. Offered by: CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 0,5g, 5G, 100 mg, 50 mg.
N,N,1,1,3,3-hexadeuterio-1,3-dideuteriooxy-2-[dideuterio(deuteriooxy)methyl]propan-2-amine (CAS 202656-13-1) is a chemical compound with the molecular formula C4H11NO3 and a molecular weight of 132.20 g/mol. IUPAC name: N,N,1,1,3,3-hexadeuterio-1,3-dideuteriooxy-2-[dideuterio(deuteriooxy)methyl]propan-2-amine. InChIKey: LENZDBCJOHFCAS-RNVFPDRBSA-N.
| Molecular formula | C4H11NO3 |
|---|---|
| Molecular weight | 132.20 g/mol |
| IUPAC name | N,N,1,1,3,3-hexadeuterio-1,3-dideuteriooxy-2-[dideuterio(deuteriooxy)methyl]propan-2-amine |
| InChIKey | LENZDBCJOHFCAS-RNVFPDRBSA-N |
| SMILES | [2H]C([2H])(C(C([2H])([2H])O[2H])(C([2H])([2H])O[2H])N([2H])[2H])O[2H] |
Computed by PubChem (NCBI)