Products 2028-14-0
CAS 2028-14-0 is the registry number for 4,4'-([1,1'-Biphenyl]-4,4'-diyl)bis(cyclohexane-1,2-dicarboxylic acid), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-(3,4-dicarboxycyclohexyl)phenyl]phenyl]cyclohexane-1,2-dicarboxylic acid (CAS 2028-14-0) is a chemical compound with the molecular formula C28H30O8 and a molecular weight of 494.5 g/mol. IUPAC name: 4-[4-[4-(3,4-dicarboxycyclohexyl)phenyl]phenyl]cyclohexane-1,2-dicarboxylic acid. InChIKey: PNOOODRIWBYSHZ-UHFFFAOYSA-N.
| Molecular formula | C28H30O8 |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | 4-[4-[4-(3,4-dicarboxycyclohexyl)phenyl]phenyl]cyclohexane-1,2-dicarboxylic acid |
| InChIKey | PNOOODRIWBYSHZ-UHFFFAOYSA-N |
| SMILES | C1CC(C(CC1C2=CC=C(C=C2)C3=CC=C(C=C3)C4CCC(C(C4)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)