CAS 202825-45-4 appears in our catalog under these names: Ralfinamide Mesylate, >95% (HPLC), Ralfinamide mesylate, Ralfinamide mesylate/ 98%, Ralfinamide (mesylate), 99.41%, (S)-2-((4-((2-Fluorobenzyl)oxy)benzyl)amino)propanamide methanesulfonate, ≥98%(HPLC). Offered by: TRC, GLPBio, TargetMol, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 25mg, 10mg, 50mg, 1mg, 5mg, 100mg, 200mg.
(2S)-2-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]propanamide;methanesulfonic acid (CAS 202825-45-4) is a chemical compound with the molecular formula C18H23FN2O5S and a molecular weight of 398.5 g/mol. IUPAC name: (2S)-2-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]propanamide;methanesulfonic acid. InChIKey: CHQVNINIGBRKGZ-YDALLXLXSA-N.
| Molecular formula | C18H23FN2O5S |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S)-2-[[4-[(2-fluorophenyl)methoxy]phenyl]methylamino]propanamide;methanesulfonic acid |
| InChIKey | CHQVNINIGBRKGZ-YDALLXLXSA-N |
| SMILES | C[C@@H](C(=O)N)NCC1=CC=C(C=C1)OCC2=CC=CC=C2F.CS(=O)(=O)O |
Computed by PubChem (NCBI)