CAS 2028284-70-8 appears in our catalog under these names: Sulfo dbco-amine, 95%, Sulfo DBCO–amine, Sulfo DBCO-amine, ≥90%, ≥90%, Sulfo DBCO-amine, 99.00%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 250mg, 5mg, 25 mg, 10 mg, 50 mg, 5 mg.
3-amino-1-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-1-oxopropane-2-sulfonic acid (CAS 2028284-70-8) is a chemical compound with the molecular formula C21H21N3O5S and a molecular weight of 427.5 g/mol. IUPAC name: 3-amino-1-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-1-oxopropane-2-sulfonic acid. InChIKey: LPNNWQSOQIRTRP-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O5S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 3-amino-1-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-1-oxopropane-2-sulfonic acid |
| InChIKey | LPNNWQSOQIRTRP-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)C(CN)S(=O)(=O)O |
Computed by PubChem (NCBI)