CAS 2028284-73-1 appears in our catalog under these names: Tos-peg5-ch2co2h, 95%, Tos–PEG4–CH2COOH, Tos-PEG4-CH2COOH 95%, 2-[2-[2-[2-[2-[[(4-Methylphenyl)sulfonyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid, 95%, 95%, Tos-PEG4-CH2COOH. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 5g, 100mg, 1 g, 250 mg, 5 g.
2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 2028284-73-1) is a chemical compound with the molecular formula C17H26O9S and a molecular weight of 406.4 g/mol. IUPAC name: 2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: MTBIBZOLTXFDIU-UHFFFAOYSA-N.
| Molecular formula | C17H26O9S |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | MTBIBZOLTXFDIU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)