CAS 2028284-75-3 appears in our catalog under these names: 3-[2-[2-[2-(3-methoxy-3-oxo-propoxy)ethoxy]ethoxy]ethoxy]propanoic acid, 97%, Acid-peg4-mono-methyl ester, 95%, Acid–PEG4–mono–methyl ester, Acid-PEG4-mono-methyl ester 97%, 3-Oxo-2,6,9,12,15-pentaoxaoctadecan-18-oic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 250 mg, 100 mg.
3-[2-[2-[2-(3-methoxy-3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2028284-75-3) is a chemical compound with the molecular formula C13H24O8 and a molecular weight of 308.32 g/mol. IUPAC name: 3-[2-[2-[2-(3-methoxy-3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MOGNNSWXCSXEEM-UHFFFAOYSA-N.
| Molecular formula | C13H24O8 |
|---|---|
| Molecular weight | 308.32 g/mol |
| IUPAC name | 3-[2-[2-[2-(3-methoxy-3-oxopropoxy)ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MOGNNSWXCSXEEM-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)