Products 2028284-76-4

CAS 2028284-76-4 is the registry number for Boc-peg2-benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate (CAS 2028284-76-4) is a chemical compound with the molecular formula C19H29NO6 and a molecular weight of 367.4 g/mol. IUPAC name: benzyl 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate. InChIKey: VFUSFIHBAGVVSH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H29NO6
Molecular weight367.4 g/mol
IUPAC namebenzyl 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoate
InChIKeyVFUSFIHBAGVVSH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCOCCOCCC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)