CAS 202831-64-9 is the registry number for 7-Bromo-9,9-diethyl-N,N-diphenyl-9H-fluoren-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-9,9-diethyl-N,N-diphenylfluoren-2-amine (CAS 202831-64-9) is a chemical compound with the molecular formula C29H26BrN and a molecular weight of 468.4 g/mol. IUPAC name: 7-bromo-9,9-diethyl-N,N-diphenylfluoren-2-amine. InChIKey: XDPFWKUUFXZLMK-UHFFFAOYSA-N.
| Molecular formula | C29H26BrN |
|---|---|
| Molecular weight | 468.4 g/mol |
| IUPAC name | 7-bromo-9,9-diethyl-N,N-diphenylfluoren-2-amine |
| InChIKey | XDPFWKUUFXZLMK-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(C=CC(=C2)N(C3=CC=CC=C3)C4=CC=CC=C4)C5=C1C=C(C=C5)Br)CC |
Computed by PubChem (NCBI)