Products 2029049-79-2
CAS 2029049-79-2 appears in our catalog under these names: ML390, ML390/ 99.85% (existing batch purity), ML–390, ML390, 99.72%, ML390 (Standard). Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 25 mg.
N-[3-oxo-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propyl]-4-(trifluoromethoxy)benzamide (CAS 2029049-79-2) is a chemical compound with the molecular formula C21H21F3N2O3 and a molecular weight of 406.4 g/mol. IUPAC name: N-[3-oxo-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propyl]-4-(trifluoromethoxy)benzamide. InChIKey: SGNRHEDBLPGDDC-GOSISDBHSA-N.
| Molecular formula | C21H21F3N2O3 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | N-[3-oxo-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propyl]-4-(trifluoromethoxy)benzamide |
| InChIKey | SGNRHEDBLPGDDC-GOSISDBHSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2C1)NC(=O)CCNC(=O)C3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)