CAS 20292-68-6 appears in our catalog under these names: Butyrylcholine perchlorate, 95%, Butyrylcholine perchlorate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2g.
2-butanoyloxyethyl(trimethyl)azanium perchlorate (CAS 20292-68-6) is a chemical compound with the molecular formula C9H20ClNO6 and a molecular weight of 273.71 g/mol. IUPAC name: 2-butanoyloxyethyl(trimethyl)azanium perchlorate. InChIKey: AOEDGUHNSUONPM-UHFFFAOYSA-M.
| Molecular formula | C9H20ClNO6 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 2-butanoyloxyethyl(trimethyl)azanium perchlorate |
| InChIKey | AOEDGUHNSUONPM-UHFFFAOYSA-M |
| SMILES | CCCC(=O)OCC[N+](C)(C)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)