Products 202979-51-9
CAS 202979-51-9 appears in our catalog under these names: L-Afegostat, 5-epi-isofagomine. Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 5mg, 1mg, 10mg, Get quote.
(3R,4R,5S)-5-(hydroxymethyl)piperidine-3,4-diol (CAS 202979-51-9) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (3R,4R,5S)-5-(hydroxymethyl)piperidine-3,4-diol. InChIKey: QPYJXFZUIJOGNX-KVQBGUIXSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (3R,4R,5S)-5-(hydroxymethyl)piperidine-3,4-diol |
| InChIKey | QPYJXFZUIJOGNX-KVQBGUIXSA-N |
| SMILES | C1[C@H]([C@H]([C@@H](CN1)O)O)CO |
Computed by PubChem (NCBI)