CAS 20302-14-1 appears in our catalog under these names: 9,9–diphenylfluorene, 9,9-Diphenylfluorene, >98.0%(GC), 9,9-Diphenylfluorene 98%, 9,9-Diphenylfluorene, 98%, 98%, 9,9-Diphenyl-9H-fluorene, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 500g, 10g.
9,9-diphenylfluorene (CAS 20302-14-1) is a chemical compound with the molecular formula C25H18 and a molecular weight of 318.4 g/mol. IUPAC name: 9,9-diphenylfluorene. InChIKey: BKQXUNGELBDWLS-UHFFFAOYSA-N.
| Molecular formula | C25H18 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 9,9-diphenylfluorene |
| InChIKey | BKQXUNGELBDWLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=CC=C5 |
Computed by PubChem (NCBI)