CAS 2030410-25-2 appears in our catalog under these names: PF 04449913 maleate, PF 04449913 maleate, Glasdegib (maleate). Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25mg, 5mg, 50mg, 100mg, Get quote.
1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea;(Z)-but-2-enedioic acid (CAS 2030410-25-2) is a chemical compound with the molecular formula C25H26N6O5 and a molecular weight of 490.5 g/mol. IUPAC name: 1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea;(Z)-but-2-enedioic acid. InChIKey: VJCVKWFBWAVYOC-UIXXXISESA-N.
| Molecular formula | C25H26N6O5 |
|---|---|
| Molecular weight | 490.5 g/mol |
| IUPAC name | 1-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methylpiperidin-4-yl]-3-(4-cyanophenyl)urea;(Z)-but-2-enedioic acid |
| InChIKey | VJCVKWFBWAVYOC-UIXXXISESA-N |
| SMILES | CN1CC[C@H](C[C@@H]1C2=NC3=CC=CC=C3N2)NC(=O)NC4=CC=C(C=C4)C#N.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)