CAS 203124-65-6 is the registry number for Dimethylarsinothioic Acid Anhydrosulfide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
[dimethylarsorylsulfanyl(methyl)arsoryl]methane (CAS 203124-65-6) is a chemical compound with the molecular formula C4H12As2O2S and a molecular weight of 274.05 g/mol. IUPAC name: [dimethylarsorylsulfanyl(methyl)arsoryl]methane. InChIKey: RXFCLJHXEHKHSM-UHFFFAOYSA-N.
| Molecular formula | C4H12As2O2S |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | [dimethylarsorylsulfanyl(methyl)arsoryl]methane |
| InChIKey | RXFCLJHXEHKHSM-UHFFFAOYSA-N |
| SMILES | C[As](=O)(C)S[As](=O)(C)C |
Computed by PubChem (NCBI)