CAS 2031241-93-5 appears in our catalog under these names: (1R)-1-Methyl-2,3-dihydro-1H-isoindole hydrochloride, 95%, (1R)-1-Methyl-2,3-dihydro-1H-isoindole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1R)-1-methyl-2,3-dihydro-1H-isoindole;hydrochloride (CAS 2031241-93-5) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. IUPAC name: (1R)-1-methyl-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: UFJGGSPSJKJHKR-OGFXRTJISA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | (1R)-1-methyl-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | UFJGGSPSJKJHKR-OGFXRTJISA-N |
| SMILES | C[C@@H]1C2=CC=CC=C2CN1.Cl |
Computed by PubChem (NCBI)