CAS 2031242-51-8 is the registry number for rac-(5R,6R)-5-Amino-1-methyl-6-(1-methyl-1H-imidazol-2-yl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(5S,6S)-5-amino-1-methyl-6-(1-methylimidazol-2-yl)piperidin-2-one (CAS 2031242-51-8) is a chemical compound with the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. IUPAC name: (5S,6S)-5-amino-1-methyl-6-(1-methylimidazol-2-yl)piperidin-2-one. InChIKey: PACLKHBNVQVCHW-CBAPKCEASA-N.
| Molecular formula | C10H16N4O |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | (5S,6S)-5-amino-1-methyl-6-(1-methylimidazol-2-yl)piperidin-2-one |
| InChIKey | PACLKHBNVQVCHW-CBAPKCEASA-N |
| SMILES | CN1C=CN=C1[C@@H]2[C@H](CCC(=O)N2C)N |
Computed by PubChem (NCBI)