Products 2031258-82-7

CAS 2031258-82-7 appears in our catalog under these names: 4-(Trifluoromethyl)tetrahydrothiophene-3-carboxylic acid 1,1-dioxide, 95%, Tetrahydro-​4-​(trifluoromethyl)​-​3-​thiophenecarboxylic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,1-dioxo-4-(trifluoromethyl)thiolane-3-carboxylic acid (CAS 2031258-82-7) is a chemical compound with the molecular formula C6H7F3O4S and a molecular weight of 232.18 g/mol. IUPAC name: 1,1-dioxo-4-(trifluoromethyl)thiolane-3-carboxylic acid. InChIKey: QEHAGODANYMGKI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7F3O4S
Molecular weight232.18 g/mol
IUPAC name1,1-dioxo-4-(trifluoromethyl)thiolane-3-carboxylic acid
InChIKeyQEHAGODANYMGKI-UHFFFAOYSA-N
SMILESC1C(C(CS1(=O)=O)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)