CAS 2031258-82-7 appears in our catalog under these names: 4-(Trifluoromethyl)tetrahydrothiophene-3-carboxylic acid 1,1-dioxide, 95%, Tetrahydro-​4-​(trifluoromethyl)​-​3-​thiophenecarboxylic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
1,1-dioxo-4-(trifluoromethyl)thiolane-3-carboxylic acid (CAS 2031258-82-7) is a chemical compound with the molecular formula C6H7F3O4S and a molecular weight of 232.18 g/mol. IUPAC name: 1,1-dioxo-4-(trifluoromethyl)thiolane-3-carboxylic acid. InChIKey: QEHAGODANYMGKI-UHFFFAOYSA-N.
| Molecular formula | C6H7F3O4S |
|---|---|
| Molecular weight | 232.18 g/mol |
| IUPAC name | 1,1-dioxo-4-(trifluoromethyl)thiolane-3-carboxylic acid |
| InChIKey | QEHAGODANYMGKI-UHFFFAOYSA-N |
| SMILES | C1C(C(CS1(=O)=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)