CAS 2031259-36-4 is the registry number for (4-Bromophenyl)(1-methyl-1H-imidazol-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(4-bromophenyl)-(1-methylimidazol-2-yl)methanamine;dihydrochloride (CAS 2031259-36-4) is a chemical compound with the molecular formula C11H14BrCl2N3 and a molecular weight of 339.06 g/mol. IUPAC name: (4-bromophenyl)-(1-methylimidazol-2-yl)methanamine;dihydrochloride. InChIKey: YAASTHWOHAQEFF-UHFFFAOYSA-N.
| Molecular formula | C11H14BrCl2N3 |
|---|---|
| Molecular weight | 339.06 g/mol |
| IUPAC name | (4-bromophenyl)-(1-methylimidazol-2-yl)methanamine;dihydrochloride |
| InChIKey | YAASTHWOHAQEFF-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(C2=CC=C(C=C2)Br)N.Cl.Cl |
Computed by PubChem (NCBI)