CAS 203126-21-0 appears in our catalog under these names: P-Methylphenylsulfur pentafluoride, 95%, p-Tolylsulfur Pentafluoride, 95%, p–Tolylsulfur Pentafluoride, 4-Methyl(pentafluorosulfanyl)benzene, p-Tolylsulfur Pentafluoride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg.
Pentafluoro-(4-methylphenyl)-lambda6-sulfane (CAS 203126-21-0) is a chemical compound with the molecular formula C7H7F5S and a molecular weight of 218.19 g/mol. IUPAC name: pentafluoro-(4-methylphenyl)-lambda6-sulfane. InChIKey: MFSRNICSILXXMS-UHFFFAOYSA-N.
| Molecular formula | C7H7F5S |
|---|---|
| Molecular weight | 218.19 g/mol |
| IUPAC name | pentafluoro-(4-methylphenyl)-lambda6-sulfane |
| InChIKey | MFSRNICSILXXMS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)