CAS 2031260-70-3 appears in our catalog under these names: 2-(4-Bromo-2-chlorophenyl)-2,2-difluoroethan-1-amine hydrochloride, 95%, 2-(4-Bromo-2-chlorophenyl)-2,2-difluoroethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-bromo-2-chlorophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 2031260-70-3) is a chemical compound with the molecular formula C8H8BrCl2F2N and a molecular weight of 306.96 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: IELMGMWKSVLOAO-UHFFFAOYSA-N.
| Molecular formula | C8H8BrCl2F2N |
|---|---|
| Molecular weight | 306.96 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | IELMGMWKSVLOAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)C(CN)(F)F.Cl |
Computed by PubChem (NCBI)