CAS 2031268-71-8 appears in our catalog under these names: Methyl 3-bromo-4H,5H,6H-thieno(2,3-c)pyrrole-2-carboxylate hydrochloride, 95%, Methyl 3-bromo-4H,5H,6H-thieno(2,3-c)pyrrole-2-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 3-bromo-5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylate;hydrochloride (CAS 2031268-71-8) is a chemical compound with the molecular formula C8H9BrClNO2S and a molecular weight of 298.59 g/mol. IUPAC name: methyl 3-bromo-5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylate;hydrochloride. InChIKey: FWZNBRKFBXIRGD-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO2S |
|---|---|
| Molecular weight | 298.59 g/mol |
| IUPAC name | methyl 3-bromo-5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylate;hydrochloride |
| InChIKey | FWZNBRKFBXIRGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)CNC2)Br.Cl |
Computed by PubChem (NCBI)