CAS 2031268-82-1 is the registry number for 1-(Pyridin-2-yl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-pyridin-2-yl-5-(trifluoromethyl)pyrazole-4-carboxylic acid;hydrochloride (CAS 2031268-82-1) is a chemical compound with the molecular formula C10H7ClF3N3O2 and a molecular weight of 293.63 g/mol. IUPAC name: 1-pyridin-2-yl-5-(trifluoromethyl)pyrazole-4-carboxylic acid;hydrochloride. InChIKey: UAVCMEYXLBCROK-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF3N3O2 |
|---|---|
| Molecular weight | 293.63 g/mol |
| IUPAC name | 1-pyridin-2-yl-5-(trifluoromethyl)pyrazole-4-carboxylic acid;hydrochloride |
| InChIKey | UAVCMEYXLBCROK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N2C(=C(C=N2)C(=O)O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)