CAS 203186-58-7 is the registry number for (E)-Ethyl 2-((dimethylamino)methylene)-3-oxobutanoate, 98%. Offered by: AmBeed. Available pack sizes: 25g, 5g.
Ethyl (2E)-2-(dimethylaminomethylidene)-3-oxobutanoate (CAS 203186-58-7) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: ethyl (2E)-2-(dimethylaminomethylidene)-3-oxobutanoate. InChIKey: LQSOVGAUOHMPLK-SOFGYWHQSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | ethyl (2E)-2-(dimethylaminomethylidene)-3-oxobutanoate |
| InChIKey | LQSOVGAUOHMPLK-SOFGYWHQSA-N |
| SMILES | CCOC(=O)/C(=C/N(C)C)/C(=O)C |
Computed by PubChem (NCBI)