CAS 2033064-46-7 is the registry number for Sulfasalazine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
N-pyridin-2-yl-4-[4-(pyridin-2-ylsulfamoyl)anilino]benzenesulfonamide (CAS 2033064-46-7) is a chemical compound with the molecular formula C22H19N5O4S2 and a molecular weight of 481.6 g/mol. IUPAC name: N-pyridin-2-yl-4-[4-(pyridin-2-ylsulfamoyl)anilino]benzenesulfonamide. InChIKey: VLXOPSHZTFCDQZ-UHFFFAOYSA-N.
| Molecular formula | C22H19N5O4S2 |
|---|---|
| Molecular weight | 481.6 g/mol |
| IUPAC name | N-pyridin-2-yl-4-[4-(pyridin-2-ylsulfamoyl)anilino]benzenesulfonamide |
| InChIKey | VLXOPSHZTFCDQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)NC3=CC=C(C=C3)S(=O)(=O)NC4=CC=CC=N4 |
Computed by PubChem (NCBI)