CAS 2033078-02-1 appears in our catalog under these names: 1-(8-Bromodibenzo[b,d]thiophen-2-yl)ethanone, 95%, 1-(8-Bromodibenzo(b,d)thiophen-2-yl)ethanone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 50g, 1g, 25g, 10g, 5g.
1-(8-bromodibenzothiophen-2-yl)ethanone (CAS 2033078-02-1) is a chemical compound with the molecular formula C14H9BrOS and a molecular weight of 305.19 g/mol. IUPAC name: 1-(8-bromodibenzothiophen-2-yl)ethanone. InChIKey: ZEFWUNKKWUMIBD-UHFFFAOYSA-N.
| Molecular formula | C14H9BrOS |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | 1-(8-bromodibenzothiophen-2-yl)ethanone |
| InChIKey | ZEFWUNKKWUMIBD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)SC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)