CAS 203308-91-2 appears in our catalog under these names: (2R)-2-amino-5-carbamimidamidopentanamide dihydrochloride, 98%, H–D–Arg–NH2?2HCl, H-D-Arg-NH2*2HCl, H-D-Arg-NH2, H-D-Arg-NH2.2HCl, 90%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-amino-5-(diaminomethylideneamino)pentanamide (CAS 203308-91-2) is a chemical compound with the molecular formula C6H15N5O and a molecular weight of 173.22 g/mol. IUPAC name: (2R)-2-amino-5-(diaminomethylideneamino)pentanamide. InChIKey: ULEBESPCVWBNIF-SCSAIBSYSA-N.
| Molecular formula | C6H15N5O |
|---|---|
| Molecular weight | 173.22 g/mol |
| IUPAC name | (2R)-2-amino-5-(diaminomethylideneamino)pentanamide |
| InChIKey | ULEBESPCVWBNIF-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)N)N)CN=C(N)N |
Computed by PubChem (NCBI)