CAS 2034156-75-5 is the registry number for 3-Bromo-4-oxo-4H-chromen-7-yl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-bromo-4-oxochromen-7-yl) methanesulfonate (CAS 2034156-75-5) is a chemical compound with the molecular formula C10H7BrO5S and a molecular weight of 319.13 g/mol. IUPAC name: (3-bromo-4-oxochromen-7-yl) methanesulfonate. InChIKey: RNNZKXUPBJKEBP-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO5S |
|---|---|
| Molecular weight | 319.13 g/mol |
| IUPAC name | (3-bromo-4-oxochromen-7-yl) methanesulfonate |
| InChIKey | RNNZKXUPBJKEBP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC2=C(C=C1)C(=O)C(=CO2)Br |
Computed by PubChem (NCBI)