CAS 20344-15-4 is the registry number for Mepiprazole Dihydrochloride. Offered by: TRC. Available pack sizes: 25mg.
1-(3-chlorophenyl)-4-[2-(5-methyl-1H-pyrazol-3-yl)ethyl]piperazine;dihydrochloride (CAS 20344-15-4) is a chemical compound with the molecular formula C16H23Cl3N4 and a molecular weight of 377.7 g/mol. IUPAC name: 1-(3-chlorophenyl)-4-[2-(5-methyl-1H-pyrazol-3-yl)ethyl]piperazine;dihydrochloride. InChIKey: FOZDCFRVHJVSIY-UHFFFAOYSA-N.
| Molecular formula | C16H23Cl3N4 |
|---|---|
| Molecular weight | 377.7 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-4-[2-(5-methyl-1H-pyrazol-3-yl)ethyl]piperazine;dihydrochloride |
| InChIKey | FOZDCFRVHJVSIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)CCN2CCN(CC2)C3=CC(=CC=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)