CAS 2034422-65-4 is the registry number for 5-(4-Fluoropyrrolidin-2-yl)-3-(pyridin-2-yl)-1,2,4-oxadiazole dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-fluoropyrrolidin-2-yl)-3-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride (CAS 2034422-65-4) is a chemical compound with the molecular formula C11H13Cl2FN4O and a molecular weight of 307.15 g/mol. IUPAC name: 5-(4-fluoropyrrolidin-2-yl)-3-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride. InChIKey: GBDIIORONQGMGD-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2FN4O |
|---|---|
| Molecular weight | 307.15 g/mol |
| IUPAC name | 5-(4-fluoropyrrolidin-2-yl)-3-pyridin-2-yl-1,2,4-oxadiazole;dihydrochloride |
| InChIKey | GBDIIORONQGMGD-UHFFFAOYSA-N |
| SMILES | C1C(CNC1C2=NC(=NO2)C3=CC=CC=N3)F.Cl.Cl |
Computed by PubChem (NCBI)