Products 203521-95-3
CAS 203521-95-3 appears in our catalog under these names: N-Cbz-4-methylisonipecotic acid ethyl ester, 95%, 1-Benzyl 4-ethyl 4-methylpiperidine-1,4-dicarboxylate, 97%, 1–benzyl 4–ethyl 4–methylpiperidine–1，4–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-O-benzyl 4-O-ethyl 4-methylpiperidine-1,4-dicarboxylate (CAS 203521-95-3) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: 1-O-benzyl 4-O-ethyl 4-methylpiperidine-1,4-dicarboxylate. InChIKey: SYAKUJRVWRTGOB-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-ethyl 4-methylpiperidine-1,4-dicarboxylate |
| InChIKey | SYAKUJRVWRTGOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)
Synonyms:
1-Benzyl 4-ethyl 4-methylpiperidine-1,4-dicarboxylate, 1-Benzyl4-ethyl4-methylpiperidine-1,4-dicarboxylate, O1-benzyl O4-ethyl 4-methylpiperidine-1,4-dicarboxylate, 1-O-benzyl 4-O-ethyl 4-methylpiperidine-1,4-dicarboxylate, SYAKUJRVWRTGOB-UHFFFAOYSA-N, 1,4-Piperidinedicarboxylic acid, 4-methyl-, 4-ethyl 1-(phenylmethyl) ester, 4-Methyl-1,4-piperidinedicarboxylic acid 4-ethyl 1-(phenylmethyl) ester