Products 20353-93-9

CAS 20353-93-9 appears in our catalog under these names: (([(Dimethylamino)methylidene]amino)methylidene)dimethylazanium chloride, 97%, Gold's Reagent, Gold's Reagent, >97.0%(HPLC)(T), Gold's Reagent 95%, GOLD'S REAGENT, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

(dimethylaminomethylideneamino)methylidene-dimethylazanium chloride (CAS 20353-93-9) is a chemical compound with the molecular formula C6H14ClN3 and a molecular weight of 163.65 g/mol. IUPAC name: (dimethylaminomethylideneamino)methylidene-dimethylazanium chloride. InChIKey: DEIBXAPEZDJDRC-UHFFFAOYSA-M.

Identity
Molecular formulaC6H14ClN3
Molecular weight163.65 g/mol
IUPAC name(dimethylaminomethylideneamino)methylidene-dimethylazanium chloride
InChIKeyDEIBXAPEZDJDRC-UHFFFAOYSA-M
SMILESCN(C)C=NC=[N+](C)C.[Cl-]

Computed by PubChem (NCBI)