Products 203578-32-9
CAS 203578-32-9 appears in our catalog under these names: Dibutylamine-d18, Di-n-butyl-d18-amine, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 2,5mg, 5mg, 0,1g, 0,05g.
1,1,2,2,3,3,4,4,4-nonadeuterio-N-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)butan-1-amine (CAS 203578-32-9) is a chemical compound with the molecular formula C8H19N and a molecular weight of 147.35 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuterio-N-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)butan-1-amine. InChIKey: JQVDAXLFBXTEQA-VAZJTQEUSA-N.
| Molecular formula | C8H19N |
|---|---|
| Molecular weight | 147.35 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonadeuterio-N-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)butan-1-amine |
| InChIKey | JQVDAXLFBXTEQA-VAZJTQEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Dibutylamine-d18, Dibutyl-d18-amine, 98 atom % D