CAS 203585-45-9 is the registry number for O-(4-Hydroxyphenyl)-3,5-diiodo-l-tyrosine methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoate (CAS 203585-45-9) is a chemical compound with the molecular formula C16H15I2NO4 and a molecular weight of 539.10 g/mol. IUPAC name: methyl (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoate. InChIKey: ZNUQUHHTCGWFOR-AWEZNQCLSA-N.
| Molecular formula | C16H15I2NO4 |
|---|---|
| Molecular weight | 539.10 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoate |
| InChIKey | ZNUQUHHTCGWFOR-AWEZNQCLSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=C(C(=C1)I)OC2=CC=C(C=C2)O)I)N |
Computed by PubChem (NCBI)