Products 2035912-43-5
CAS 2035912-43-5 is the registry number for LSD1-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(2-bromo-4,5-dihydroxyphenyl)ethenyl]-N'-hydroxybenzenecarboximidamide (CAS 2035912-43-5) is a chemical compound with the molecular formula C15H13BrN2O3 and a molecular weight of 349.18 g/mol. IUPAC name: 4-[(E)-2-(2-bromo-4,5-dihydroxyphenyl)ethenyl]-N'-hydroxybenzenecarboximidamide. InChIKey: JDEDYOAMPIVKCF-ZZXKWVIFSA-N.
| Molecular formula | C15H13BrN2O3 |
|---|---|
| Molecular weight | 349.18 g/mol |
| IUPAC name | 4-[(E)-2-(2-bromo-4,5-dihydroxyphenyl)ethenyl]-N'-hydroxybenzenecarboximidamide |
| InChIKey | JDEDYOAMPIVKCF-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=C(C=C2Br)O)O)/C(=N/O)/N |
Computed by PubChem (NCBI)