CAS 2036-39-7 is the registry number for Thiophene-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
2,3,4,5-tetradeuteriothiophene (CAS 2036-39-7) is a chemical compound with the molecular formula C4H4S and a molecular weight of 88.17 g/mol. IUPAC name: 2,3,4,5-tetradeuteriothiophene. InChIKey: YTPLMLYBLZKORZ-RHQRLBAQSA-N.
| Molecular formula | C4H4S |
|---|---|
| Molecular weight | 88.17 g/mol |
| IUPAC name | 2,3,4,5-tetradeuteriothiophene |
| InChIKey | YTPLMLYBLZKORZ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(SC(=C1[2H])[2H])[2H] |
Computed by PubChem (NCBI)