CAS 2036-62-6 is the registry number for Chloropentafluoroacetone, monohydrate, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
1-chloro-1,1,3,3,3-pentafluoropropan-2-one;hydrate (CAS 2036-62-6) is a chemical compound with the molecular formula C3H2ClF5O2 and a molecular weight of 200.49 g/mol. IUPAC name: 1-chloro-1,1,3,3,3-pentafluoropropan-2-one;hydrate. InChIKey: CMMNKPFHVMVGQH-UHFFFAOYSA-N.
| Molecular formula | C3H2ClF5O2 |
|---|---|
| Molecular weight | 200.49 g/mol |
| IUPAC name | 1-chloro-1,1,3,3,3-pentafluoropropan-2-one;hydrate |
| InChIKey | CMMNKPFHVMVGQH-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(F)F)C(F)(F)Cl.O |
Computed by PubChem (NCBI)