CAS 2036044-77-4 appears in our catalog under these names: Porcn-IN-1/ 99.61% (existing batch purity), Porcupine–IN–1, N-((3-Fluoro-2'-methyl-[2,4'-bipyridin]-5-yl)methyl)-9H-carbazole-2-carboxamide, 97%, 97%, Porcn-IN-1, 99.57%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 100 mg.
N-[[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methyl]-9H-carbazole-2-carboxamide (CAS 2036044-77-4) is a chemical compound with the molecular formula C25H19FN4O and a molecular weight of 410.4 g/mol. IUPAC name: N-[[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methyl]-9H-carbazole-2-carboxamide. InChIKey: GOMFFTZBKYVUOE-UHFFFAOYSA-N.
| Molecular formula | C25H19FN4O |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | N-[[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methyl]-9H-carbazole-2-carboxamide |
| InChIKey | GOMFFTZBKYVUOE-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)C2=C(C=C(C=N2)CNC(=O)C3=CC4=C(C=C3)C5=CC=CC=C5N4)F |
Computed by PubChem (NCBI)