CAS 203626-29-3 is the registry number for 4-Chloro-6,8-dibromo-2-methylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6,8-dibromo-4-chloro-2-methylquinoline (CAS 203626-29-3) is a chemical compound with the molecular formula C10H6Br2ClN and a molecular weight of 335.42 g/mol. IUPAC name: 6,8-dibromo-4-chloro-2-methylquinoline. InChIKey: UJAIYNLCWBKOPO-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2ClN |
|---|---|
| Molecular weight | 335.42 g/mol |
| IUPAC name | 6,8-dibromo-4-chloro-2-methylquinoline |
| InChIKey | UJAIYNLCWBKOPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=C(C2=N1)Br)Br)Cl |
Computed by PubChem (NCBI)